Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A10206A | Purity: >98% |
 | |
| Chemical structure of Pinacidil monohydrate |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 85371-64-8 |
|---|---|
| Purity | >98% |
| Formula | C13H21N5O |
| Mol Weight | 263.3387 |
| CoA | CoA of Pinacidil monohydrate |
| Smiles: | [H]O[H].CC(C)(C)C(N/C(NC#N)=N/C1=CC=NC=C1)C |
|---|
KEYWORDS: buy Pinacidil monohydrate | Pinacidil monohydrate supplier | purchase | cost | manufacturer | order | distributor | buy 85371-64-8 | 85371-64-8 supplier